China C8H12O2 Manufacturers Factory Suppliers
WebDates. Create: 2005-03-26. Modify: 2023-12-30. Description. 2-octynoic acid is an acetylenic fatty acid that is octanoic acid ( caprylic acid) which has been doubly dehydrogenated at...
WebFound 3963 results. Search term: C8H12O2 (Found by molecular formula) 1. 2. 3. 4. 5. ID. Structure....
WebMolar Mass, Molecular Weight and Elemental Composition Calculator. Molar mass of C8H12O2 (Vinylcyclohexene dioxide) is 140.1797 g/mol. Get control of 2022! Track your...
WebWord Equation. Dimedone + Dioxygen = Carbon Dioxide + Water. C8H12O2 + O2 = CO2 + H2O is a Combustion reaction where one mole of Dimedone [C 8 H 12 O 2] and ten...
WebC8H12O2: Molecular Weight: 140.17968 g/mol: IUPAC Name: 5,5-dimethylcyclohexane-1,3-dione: SMILES String: CC1(C)CC(=O)CC(=O)C1: InChI: InChI=1S/C8H12O2/c1-8(2)4-6(9)3-7(10)5-8/h3-5H2,1-2H3:...
Web2-Acetylcyclohexanone | C8H12O2 | CID 13400 - structure, chemical names, physical and chemical properties, classification, patents, literature, biological activities, safety/hazards/toxicity...





![Tert-Butyl 3-hydroxy-8-azabicyclo[3.2.1]octane-8-carboxylate CAS 478837-18-2](/uploads/202340914/small/tert-butyl-3-hydroxy-8-azabicyclo-3-2-1433520c3-b1f8-4f40-acc8-bb7cfa2e415e.jpg)




![1H-Benzo[d]imidazole-6-carbonitrile CAS 6287-83-8](/uploads/40914/small/1h-benzo-d-imidazole-6-carbonitrile-cas-6287a370f.png)





